C20H24N2O8S2 — CID 21496766
3-[benzenesulfonyl-[2-[benzenesulfonyl(2-carboxyethyl)amino]ethyl]amino]propanoic acid (PubChem CID 21496766) has the molecular formula C20H24N2O8S2 and a molecular weight of 484.55 g/mol. Its IUPAC name is 3-[benzenesulfonyl-[2-[benzenesulfonyl(2-carboxyethyl)amino]ethyl]amino]propanoic acid.
| Compound Name | 3-[benzenesulfonyl-[2-[benzenesulfonyl(2-carboxyethyl)amino]ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 21496766 |
| Molecular Formula | C20H24N2O8S2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 3-[benzenesulfonyl-[2-[benzenesulfonyl(2-carboxyethyl)amino]ethyl]amino]propanoic acid |
| SMILES | O=C(O)CCN(CCN(CCC(=O)O)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O8S2/c23-19(24)11-13-21(31(27,28)17-7-3-1-4-8-17)15-16-22(14-12-20(25)26)32(29,30)18-9-5-2-6-10-18/h1-10H,11-16H2,(H,23,24)(H,25,26) |
| InChIKey | UMAYBFFOGBMYHE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |