C11H12N2O8S — CID 175653547
3-[carboxymethyl-(4-nitrophenyl)sulfonylamino]propanoic acid (PubChem CID 175653547) has the molecular formula C11H12N2O8S and a molecular weight of 332.29 g/mol. Its IUPAC name is 3-[carboxymethyl-(4-nitrophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[carboxymethyl-(4-nitrophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 175653547 |
| Molecular Formula | C11H12N2O8S |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 3-[carboxymethyl-(4-nitrophenyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)CCN(CC(=O)O)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H12N2O8S/c14-10(15)5-6-12(7-11(16)17)22(20,21)9-3-1-8(2-4-9)13(18)19/h1-4H,5-7H2,(H,14,15)(H,16,17) |
| InChIKey | BTYLBNANRAKSFD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|