C12H16N2O6S — CID 61008891
3-[ethyl-(4-methyl-3-nitrophenyl)sulfonylamino]propanoic acid (PubChem CID 61008891) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is 3-[ethyl-(4-methyl-3-nitrophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[ethyl-(4-methyl-3-nitrophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 61008891 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3-[ethyl-(4-methyl-3-nitrophenyl)sulfonylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N2O6S/c1-3-13(7-6-12(15)16)21(19,20)10-5-4-9(2)11(8-10)14(17)18/h4-5,8H,3,6-7H2,1-2H3,(H,15,16) |
| InChIKey | VTHRLCFJFIBPFZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|