C14H15ClN2O4S2 — CID 9301949
N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 9301949) has the molecular formula C14H15ClN2O4S2 and a molecular weight of 374.87 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9301949 |
| Molecular Formula | C14H15ClN2O4S2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(Cc1ccc(Cl)s1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15ClN2O4S2/c1-3-16(9-11-5-7-14(15)22-11)23(20,21)12-6-4-10(2)13(8-12)17(18)19/h4-8H,3,9H2,1-2H3 |
| InChIKey | MHJUJYKJTIVRFZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|