C12H16N2O4S — CID 24679119
N-cyclopropyl-N-ethyl-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 24679119) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is N-cyclopropyl-N-ethyl-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-cyclopropyl-N-ethyl-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24679119 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-cyclopropyl-N-ethyl-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(C1CC1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N2O4S/c1-3-13(10-5-6-10)19(17,18)11-7-4-9(2)12(8-11)14(15)16/h4,7-8,10H,3,5-6H2,1-2H3 |
| InChIKey | YXZAXZXRXZFOCS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|