C14H16ClNO4S3 — CID 134002462
N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3-methylsulfonylbenzenesulfonamide (PubChem CID 134002462) has the molecular formula C14H16ClNO4S3 and a molecular weight of 393.94 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 134002462 |
| Molecular Formula | C14H16ClNO4S3 |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3-methylsulfonylbenzenesulfonamide |
| SMILES | CCN(Cc1ccc(Cl)s1)S(=O)(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H16ClNO4S3/c1-3-16(10-11-7-8-14(15)21-11)23(19,20)13-6-4-5-12(9-13)22(2,17)18/h4-9H,3,10H2,1-2H3 |
| InChIKey | FQZXHBMXJJCXLM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |