C12H12ClNO5S2 — CID 60954031
5-[(5-chlorothiophen-2-yl)methyl-ethylsulfamoyl]furan-2-carboxylic acid (PubChem CID 60954031) has the molecular formula C12H12ClNO5S2 and a molecular weight of 349.82 g/mol. Its IUPAC name is 5-[(5-chlorothiophen-2-yl)methyl-ethylsulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-[(5-chlorothiophen-2-yl)methyl-ethylsulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 60954031 |
| Molecular Formula | C12H12ClNO5S2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 5-[(5-chlorothiophen-2-yl)methyl-ethylsulfamoyl]furan-2-carboxylic acid |
| SMILES | CCN(Cc1ccc(Cl)s1)S(=O)(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C12H12ClNO5S2/c1-2-14(7-8-3-5-10(13)20-8)21(17,18)11-6-4-9(19-11)12(15)16/h3-6H,2,7H2,1H3,(H,15,16) |
| InChIKey | VCLIMWMJTSORSI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |