C11H10ClNO4S3 — CID 60709103
3-[(5-chlorothiophen-2-yl)methyl-methylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 60709103) has the molecular formula C11H10ClNO4S3 and a molecular weight of 351.86 g/mol. Its IUPAC name is 3-[(5-chlorothiophen-2-yl)methyl-methylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[(5-chlorothiophen-2-yl)methyl-methylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 60709103 |
| Molecular Formula | C11H10ClNO4S3 |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 3-[(5-chlorothiophen-2-yl)methyl-methylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CN(Cc1ccc(Cl)s1)S(=O)(=O)c1ccsc1C(=O)O |
| InChI | InChI=1S/C11H10ClNO4S3/c1-13(6-7-2-3-9(12)19-7)20(16,17)8-4-5-18-10(8)11(14)15/h2-5H,6H2,1H3,(H,14,15) |
| InChIKey | ADQNHHYJETXBPK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |