C12H12ClNO4S3 — CID 60948492
5-[(5-chlorothiophen-2-yl)methyl-methylsulfamoyl]-3-methylthiophene-2-carboxylic acid (PubChem CID 60948492) has the molecular formula C12H12ClNO4S3 and a molecular weight of 365.89 g/mol. Its IUPAC name is 5-[(5-chlorothiophen-2-yl)methyl-methylsulfamoyl]-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-[(5-chlorothiophen-2-yl)methyl-methylsulfamoyl]-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 60948492 |
| Molecular Formula | C12H12ClNO4S3 |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | 5-[(5-chlorothiophen-2-yl)methyl-methylsulfamoyl]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)N(C)Cc2ccc(Cl)s2)sc1C(=O)O |
| InChI | InChI=1S/C12H12ClNO4S3/c1-7-5-10(20-11(7)12(15)16)21(17,18)14(2)6-8-3-4-9(13)19-8/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | IVRGJQMPUKSQSC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |