C13H14ClFN2O2S2 — CID 115421383
3-amino-N-[(5-chlorothiophen-2-yl)methyl]-4-fluoro-N,5-dimethylbenzenesulfonamide (PubChem CID 115421383) has the molecular formula C13H14ClFN2O2S2 and a molecular weight of 348.85 g/mol. Its IUPAC name is 3-amino-N-[(5-chlorothiophen-2-yl)methyl]-4-fluoro-N,5-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-[(5-chlorothiophen-2-yl)methyl]-4-fluoro-N,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 115421383 |
| Molecular Formula | C13H14ClFN2O2S2 |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 3-amino-N-[(5-chlorothiophen-2-yl)methyl]-4-fluoro-N,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)Cc2ccc(Cl)s2)cc(N)c1F |
| InChI | InChI=1S/C13H14ClFN2O2S2/c1-8-5-10(6-11(16)13(8)15)21(18,19)17(2)7-9-3-4-12(14)20-9/h3-6H,7,16H2,1-2H3 |
| InChIKey | LFACTTXRZIECGD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|