C14H16FN3O2S — CID 115421252
3-amino-4-fluoro-N,5-dimethyl-N-(pyridin-2-ylmethyl)benzenesulfonamide (PubChem CID 115421252) has the molecular formula C14H16FN3O2S and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-amino-4-fluoro-N,5-dimethyl-N-(pyridin-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-amino-4-fluoro-N,5-dimethyl-N-(pyridin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115421252 |
| Molecular Formula | C14H16FN3O2S |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 3-amino-4-fluoro-N,5-dimethyl-N-(pyridin-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)Cc2ccccn2)cc(N)c1F |
| InChI | InChI=1S/C14H16FN3O2S/c1-10-7-12(8-13(16)14(10)15)21(19,20)18(2)9-11-5-3-4-6-17-11/h3-8H,9,16H2,1-2H3 |
| InChIKey | XQNSOVQRROMEHJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|