C12H11ClF2N2O2S2 — CID 61125967
5-amino-N-[(5-chlorothiophen-2-yl)methyl]-2,4-difluoro-N-methylbenzenesulfonamide (PubChem CID 61125967) has the molecular formula C12H11ClF2N2O2S2 and a molecular weight of 352.82 g/mol. Its IUPAC name is 5-amino-N-[(5-chlorothiophen-2-yl)methyl]-2,4-difluoro-N-methylbenzenesulfonamide.
| Compound Name | 5-amino-N-[(5-chlorothiophen-2-yl)methyl]-2,4-difluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61125967 |
| Molecular Formula | C12H11ClF2N2O2S2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 5-amino-N-[(5-chlorothiophen-2-yl)methyl]-2,4-difluoro-N-methylbenzenesulfonamide |
| SMILES | CN(Cc1ccc(Cl)s1)S(=O)(=O)c1cc(N)c(F)cc1F |
| InChI | InChI=1S/C12H11ClF2N2O2S2/c1-17(6-7-2-3-12(13)20-7)21(18,19)11-5-10(16)8(14)4-9(11)15/h2-5H,6,16H2,1H3 |
| InChIKey | DNKMRDCYIJUPDU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|