C12H13F2N3O2S2 — CID 63843262
5-amino-2,4-difluoro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide (PubChem CID 63843262) has the molecular formula C12H13F2N3O2S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide.
| Compound Name | 5-amino-2,4-difluoro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63843262 |
| Molecular Formula | C12H13F2N3O2S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 5-amino-2,4-difluoro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ncsc1CN(C)S(=O)(=O)c1cc(N)c(F)cc1F |
| InChI | InChI=1S/C12H13F2N3O2S2/c1-7-11(20-6-16-7)5-17(2)21(18,19)12-4-10(15)8(13)3-9(12)14/h3-4,6H,5,15H2,1-2H3 |
| InChIKey | TUUXCGFBEAIHEL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|