C11H17F2N3O2S — CID 55226750
5-amino-N-[2-(dimethylamino)ethyl]-2,4-difluoro-N-methylbenzenesulfonamide (PubChem CID 55226750) has the molecular formula C11H17F2N3O2S and a molecular weight of 293.34 g/mol. Its IUPAC name is 5-amino-N-[2-(dimethylamino)ethyl]-2,4-difluoro-N-methylbenzenesulfonamide.
| Compound Name | 5-amino-N-[2-(dimethylamino)ethyl]-2,4-difluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55226750 |
| Molecular Formula | C11H17F2N3O2S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 5-amino-N-[2-(dimethylamino)ethyl]-2,4-difluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C)CCN(C)S(=O)(=O)c1cc(N)c(F)cc1F |
| InChI | InChI=1S/C11H17F2N3O2S/c1-15(2)4-5-16(3)19(17,18)11-7-10(14)8(12)6-9(11)13/h6-7H,4-5,14H2,1-3H3 |
| InChIKey | OGYGEBAPQIMCNS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|