C11H17FN2O4S2 — CID 79850611
5-amino-2-fluoro-N,4-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 79850611) has the molecular formula C11H17FN2O4S2 and a molecular weight of 324.40 g/mol. Its IUPAC name is 5-amino-2-fluoro-N,4-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 5-amino-2-fluoro-N,4-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79850611 |
| Molecular Formula | C11H17FN2O4S2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 5-amino-2-fluoro-N,4-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | Cc1cc(F)c(S(=O)(=O)N(C)CCS(C)(=O)=O)cc1N |
| InChI | InChI=1S/C11H17FN2O4S2/c1-8-6-9(12)11(7-10(8)13)20(17,18)14(2)4-5-19(3,15)16/h6-7H,4-5,13H2,1-3H3 |
| InChIKey | DDOWQVFDYQALDB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|