C10H14F2N2O4S2 — CID 79849886
4-amino-2,6-difluoro-N-methyl-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 79849886) has the molecular formula C10H14F2N2O4S2 and a molecular weight of 328.36 g/mol. Its IUPAC name is 4-amino-2,6-difluoro-N-methyl-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-difluoro-N-methyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79849886 |
| Molecular Formula | C10H14F2N2O4S2 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 4-amino-2,6-difluoro-N-methyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | CN(CCS(C)(=O)=O)S(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C10H14F2N2O4S2/c1-14(3-4-19(2,15)16)20(17,18)10-8(11)5-7(13)6-9(10)12/h5-6H,3-4,13H2,1-2H3 |
| InChIKey | GANUGAZSAQISGF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|