C9H12F2N2O3S — CID 65023425
5-amino-2,3-difluoro-N-(2-hydroxyethyl)-N-methylbenzenesulfonamide (PubChem CID 65023425) has the molecular formula C9H12F2N2O3S and a molecular weight of 266.27 g/mol. Its IUPAC name is 5-amino-2,3-difluoro-N-(2-hydroxyethyl)-N-methylbenzenesulfonamide.
| Compound Name | 5-amino-2,3-difluoro-N-(2-hydroxyethyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 65023425 |
| Molecular Formula | C9H12F2N2O3S |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 5-amino-2,3-difluoro-N-(2-hydroxyethyl)-N-methylbenzenesulfonamide |
| SMILES | CN(CCO)S(=O)(=O)c1cc(N)cc(F)c1F |
| InChI | InChI=1S/C9H12F2N2O3S/c1-13(2-3-14)17(15,16)8-5-6(12)4-7(10)9(8)11/h4-5,14H,2-3,12H2,1H3 |
| InChIKey | LAJPARLTFOAIIY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|