About 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide
5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 65020823) has the molecular formula C13H18F2N2O3S
and a molecular weight of 320.36 g/mol. Its IUPAC name is 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide |
| PubChem CID | 65020823 |
| Molecular Formula | C13H18F2N2O3S |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | Nc1cc(F)c(F)c(S(=O)(=O)N(CCO)C2CCCC2)c1 |
| InChI | InChI=1S/C13H18F2N2O3S/c14-11-7-9(16)8-12(13(11)15)21(19,20)17(5-6-18)10-3-1-2-4-10/h7-8,10,18H,1-6,16H2 |
| InChIKey | GISHXJVJNHCCMP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide?
The IUPAC name of 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide (CID 65020823) is 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide.
What is the SMILES notation for 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide?
The canonical SMILES for 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide is Nc1cc(F)c(F)c(S(=O)(=O)N(CCO)C2CCCC2)c1.
What is the InChIKey of 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide?
The InChIKey is GISHXJVJNHCCMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2N2O3S/c14-11-7-9(16)8-12(13(11)15)21(19,20)17(5-6-18)10-3-1-2-4-10/h7-8,10,18H,1-6,16H2.
What are the key properties of 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide?
5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide has a molecular weight of 320.36 g/mol, XLogP of 1.47, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-cyclopentyl-2,3-difluoro-N-(2-hydroxyethyl)benzenesulfonamide is sourced from PubChem (CID 65020823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).