C10H14BrFN2O4S2 — CID 106491921
2-amino-5-bromo-4-fluoro-N-methyl-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 106491921) has the molecular formula C10H14BrFN2O4S2 and a molecular weight of 389.27 g/mol. Its IUPAC name is 2-amino-5-bromo-4-fluoro-N-methyl-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 2-amino-5-bromo-4-fluoro-N-methyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106491921 |
| Molecular Formula | C10H14BrFN2O4S2 |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | 2-amino-5-bromo-4-fluoro-N-methyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | CN(CCS(C)(=O)=O)S(=O)(=O)c1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C10H14BrFN2O4S2/c1-14(3-4-19(2,15)16)20(17,18)10-5-7(11)8(12)6-9(10)13/h5-6H,3-4,13H2,1-2H3 |
| InChIKey | XJDZBVJHPZJFBI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|