C8H10BrFN2O2S — CID 106491295
2-amino-5-bromo-4-fluoro-N,N-dimethylbenzenesulfonamide (PubChem CID 106491295) has the molecular formula C8H10BrFN2O2S and a molecular weight of 297.15 g/mol. Its IUPAC name is 2-amino-5-bromo-4-fluoro-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-amino-5-bromo-4-fluoro-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106491295 |
| Molecular Formula | C8H10BrFN2O2S |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | 2-amino-5-bromo-4-fluoro-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C8H10BrFN2O2S/c1-12(2)15(13,14)8-3-5(9)6(10)4-7(8)11/h3-4H,11H2,1-2H3 |
| InChIKey | QWSAVSMKFKTZPA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|