C9H12BrFN2O2S — CID 106491371
2-amino-5-bromo-N-ethyl-4-fluoro-N-methylbenzenesulfonamide (PubChem CID 106491371) has the molecular formula C9H12BrFN2O2S and a molecular weight of 311.18 g/mol. Its IUPAC name is 2-amino-5-bromo-N-ethyl-4-fluoro-N-methylbenzenesulfonamide.
| Compound Name | 2-amino-5-bromo-N-ethyl-4-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106491371 |
| Molecular Formula | C9H12BrFN2O2S |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 2-amino-5-bromo-N-ethyl-4-fluoro-N-methylbenzenesulfonamide |
| SMILES | CCN(C)S(=O)(=O)c1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C9H12BrFN2O2S/c1-3-13(2)16(14,15)9-4-6(10)7(11)5-8(9)12/h4-5H,3,12H2,1-2H3 |
| InChIKey | MEFOLCTUCSSONL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|