C11H16F2N2O2S — CID 114526479
4-[3-(dimethylamino)propylsulfonyl]-3,5-difluoroaniline (PubChem CID 114526479) has the molecular formula C11H16F2N2O2S and a molecular weight of 278.32 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propylsulfonyl]-3,5-difluoroaniline.
| Compound Name | 4-[3-(dimethylamino)propylsulfonyl]-3,5-difluoroaniline |
|---|---|
| PubChem CID | 114526479 |
| Molecular Formula | C11H16F2N2O2S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-[3-(dimethylamino)propylsulfonyl]-3,5-difluoroaniline |
| SMILES | CN(C)CCCS(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C11H16F2N2O2S/c1-15(2)4-3-5-18(16,17)11-9(12)6-8(14)7-10(11)13/h6-7H,3-5,14H2,1-2H3 |
| InChIKey | KHVVBHPTUGLCFF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|