C15H23F2NO2S — CID 61366703
3,5-difluoro-4-nonylsulfonylaniline (PubChem CID 61366703) has the molecular formula C15H23F2NO2S and a molecular weight of 319.42 g/mol. Its IUPAC name is 3,5-difluoro-4-nonylsulfonylaniline.
| Compound Name | 3,5-difluoro-4-nonylsulfonylaniline |
|---|---|
| PubChem CID | 61366703 |
| Molecular Formula | C15H23F2NO2S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3,5-difluoro-4-nonylsulfonylaniline |
| SMILES | CCCCCCCCCS(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C15H23F2NO2S/c1-2-3-4-5-6-7-8-9-21(19,20)15-13(16)10-12(18)11-14(15)17/h10-11H,2-9,18H2,1H3 |
| InChIKey | SXXKPZXLQMISRB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|