C8H8F2N2O3S — CID 61366888
2-(4-amino-2,6-difluorophenyl)sulfonylacetamide (PubChem CID 61366888) has the molecular formula C8H8F2N2O3S and a molecular weight of 250.23 g/mol. Its IUPAC name is 2-(4-amino-2,6-difluorophenyl)sulfonylacetamide.
| Compound Name | 2-(4-amino-2,6-difluorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 61366888 |
| Molecular Formula | C8H8F2N2O3S |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2-(4-amino-2,6-difluorophenyl)sulfonylacetamide |
| SMILES | NC(=O)CS(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C8H8F2N2O3S/c9-5-1-4(11)2-6(10)8(5)16(14,15)3-7(12)13/h1-2H,3,11H2,(H2,12,13) |
| InChIKey | LWZYLBWLTAGGPZ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|