C11H9F2NO2S2 — CID 61367469
3,5-difluoro-4-(thiophen-3-ylmethylsulfonyl)aniline (PubChem CID 61367469) has the molecular formula C11H9F2NO2S2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3,5-difluoro-4-(thiophen-3-ylmethylsulfonyl)aniline.
| Compound Name | 3,5-difluoro-4-(thiophen-3-ylmethylsulfonyl)aniline |
|---|---|
| PubChem CID | 61367469 |
| Molecular Formula | C11H9F2NO2S2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 3,5-difluoro-4-(thiophen-3-ylmethylsulfonyl)aniline |
| SMILES | Nc1cc(F)c(S(=O)(=O)Cc2ccsc2)c(F)c1 |
| InChI | InChI=1S/C11H9F2NO2S2/c12-9-3-8(14)4-10(13)11(9)18(15,16)6-7-1-2-17-5-7/h1-5H,6,14H2 |
| InChIKey | KPKVAKSGDRQKNF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|