C13H9ClF3NO2S — CID 107885871
4-[(4-chloro-3-fluorophenyl)methylsulfonyl]-3,5-difluoroaniline (PubChem CID 107885871) has the molecular formula C13H9ClF3NO2S and a molecular weight of 335.73 g/mol. Its IUPAC name is 4-[(4-chloro-3-fluorophenyl)methylsulfonyl]-3,5-difluoroaniline.
| Compound Name | 4-[(4-chloro-3-fluorophenyl)methylsulfonyl]-3,5-difluoroaniline |
|---|---|
| PubChem CID | 107885871 |
| Molecular Formula | C13H9ClF3NO2S |
| Molecular Weight | 335.73 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 4-[(4-chloro-3-fluorophenyl)methylsulfonyl]-3,5-difluoroaniline |
| SMILES | Nc1cc(F)c(S(=O)(=O)Cc2ccc(Cl)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C13H9ClF3NO2S/c14-9-2-1-7(3-10(9)15)6-21(19,20)13-11(16)4-8(18)5-12(13)17/h1-5H,6,18H2 |
| InChIKey | KFIMQPMFIBPTOR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.73 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|