C13H10Cl2FNO2S — CID 81187314
4-[(3,4-dichlorophenyl)methylsulfonyl]-2-fluoroaniline (PubChem CID 81187314) has the molecular formula C13H10Cl2FNO2S and a molecular weight of 334.20 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methylsulfonyl]-2-fluoroaniline.
| Compound Name | 4-[(3,4-dichlorophenyl)methylsulfonyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 81187314 |
| Molecular Formula | C13H10Cl2FNO2S |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methylsulfonyl]-2-fluoroaniline |
| SMILES | Nc1ccc(S(=O)(=O)Cc2ccc(Cl)c(Cl)c2)cc1F |
| InChI | InChI=1S/C13H10Cl2FNO2S/c14-10-3-1-8(5-11(10)15)7-20(18,19)9-2-4-13(17)12(16)6-9/h1-6H,7,17H2 |
| InChIKey | BNHNQRUFPPMPKC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|