C13H10Cl2O2S — CID 10968615
4-(benzenesulfonylmethyl)-1,2-dichlorobenzene (PubChem CID 10968615) has the molecular formula C13H10Cl2O2S and a molecular weight of 301.19 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-1,2-dichlorobenzene.
| Compound Name | 4-(benzenesulfonylmethyl)-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 10968615 |
| Molecular Formula | C13H10Cl2O2S |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-1,2-dichlorobenzene |
| SMILES | O=S(=O)(Cc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C13H10Cl2O2S/c14-12-7-6-10(8-13(12)15)9-18(16,17)11-4-2-1-3-5-11/h1-8H,9H2 |
| InChIKey | PXWQGJZEMHMBKY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |