C12H8Cl2O5S — CID 63943575
5-[(3,4-dichlorophenyl)methylsulfonyl]furan-2-carboxylic acid (PubChem CID 63943575) has the molecular formula C12H8Cl2O5S and a molecular weight of 335.16 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methylsulfonyl]furan-2-carboxylic acid.
| Compound Name | 5-[(3,4-dichlorophenyl)methylsulfonyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63943575 |
| Molecular Formula | C12H8Cl2O5S |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 333.95 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methylsulfonyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Cc2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C12H8Cl2O5S/c13-8-2-1-7(5-9(8)14)6-20(17,18)11-4-3-10(19-11)12(15)16/h1-5H,6H2,(H,15,16) |
| InChIKey | BVHULWULGPXGOB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |