C8H10O7S2 — CID 63943584
5-(2-methylsulfonylethylsulfonyl)furan-2-carboxylic acid (PubChem CID 63943584) has the molecular formula C8H10O7S2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-(2-methylsulfonylethylsulfonyl)furan-2-carboxylic acid.
| Compound Name | 5-(2-methylsulfonylethylsulfonyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63943584 |
| Molecular Formula | C8H10O7S2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 5-(2-methylsulfonylethylsulfonyl)furan-2-carboxylic acid |
| SMILES | CS(=O)(=O)CCS(=O)(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C8H10O7S2/c1-16(11,12)4-5-17(13,14)7-3-2-6(15-7)8(9)10/h2-3H,4-5H2,1H3,(H,9,10) |
| InChIKey | KYBMRPURDMFVNN-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |