C11H17NO5S — CID 106328341
5-(3-methylpentan-3-ylsulfamoyl)furan-2-carboxylic acid (PubChem CID 106328341) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is 5-(3-methylpentan-3-ylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-(3-methylpentan-3-ylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106328341 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-(3-methylpentan-3-ylsulfamoyl)furan-2-carboxylic acid |
| SMILES | CCC(C)(CC)NS(=O)(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C11H17NO5S/c1-4-11(3,5-2)12-18(15,16)9-7-6-8(17-9)10(13)14/h6-7,12H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | SPSVFROKDFLVAF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |