C12H18N2O7S — CID 104932979
5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]furan-2-carboxylic acid (PubChem CID 104932979) has the molecular formula C12H18N2O7S and a molecular weight of 334.35 g/mol. Its IUPAC name is 5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 104932979 |
| Molecular Formula | C12H18N2O7S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]furan-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCNS(=O)(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C12H18N2O7S/c1-12(2,3)21-11(17)13-6-7-14-22(18,19)9-5-4-8(20-9)10(15)16/h4-5,14H,6-7H2,1-3H3,(H,13,17)(H,15,16) |
| InChIKey | UYIHJZGRMVVHRD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|