C9H11NO7S — CID 39733384
3-[(5-methoxycarbonylfuran-2-yl)sulfonylamino]propanoic acid (PubChem CID 39733384) has the molecular formula C9H11NO7S and a molecular weight of 277.25 g/mol. Its IUPAC name is 3-[(5-methoxycarbonylfuran-2-yl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(5-methoxycarbonylfuran-2-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 39733384 |
| Molecular Formula | C9H11NO7S |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 3-[(5-methoxycarbonylfuran-2-yl)sulfonylamino]propanoic acid |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCCC(=O)O)o1 |
| InChI | InChI=1S/C9H11NO7S/c1-16-9(13)6-2-3-8(17-6)18(14,15)10-5-4-7(11)12/h2-3,10H,4-5H2,1H3,(H,11,12) |
| InChIKey | VYVDDFUXHKKQGU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |