C8H12N2O7S2 — CID 106335110
5-[2-(methylsulfamoyl)ethylsulfamoyl]furan-2-carboxylic acid (PubChem CID 106335110) has the molecular formula C8H12N2O7S2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 5-[2-(methylsulfamoyl)ethylsulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-[2-(methylsulfamoyl)ethylsulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106335110 |
| Molecular Formula | C8H12N2O7S2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 5-[2-(methylsulfamoyl)ethylsulfamoyl]furan-2-carboxylic acid |
| SMILES | CNS(=O)(=O)CCNS(=O)(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C8H12N2O7S2/c1-9-18(13,14)5-4-10-19(15,16)7-3-2-6(17-7)8(11)12/h2-3,9-10H,4-5H2,1H3,(H,11,12) |
| InChIKey | UKPBKJUCPBCLBT-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |