C7H6F3NO5S — CID 29077583
5-(2,2,2-trifluoroethylsulfamoyl)furan-2-carboxylic acid (PubChem CID 29077583) has the molecular formula C7H6F3NO5S and a molecular weight of 273.19 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-(2,2,2-trifluoroethylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 29077583 |
| Molecular Formula | C7H6F3NO5S |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 5-(2,2,2-trifluoroethylsulfamoyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCC(F)(F)F)o1 |
| InChI | InChI=1S/C7H6F3NO5S/c8-7(9,10)3-11-17(14,15)5-2-1-4(16-5)6(12)13/h1-2,11H,3H2,(H,12,13) |
| InChIKey | KQUPOLUORLABKR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |