C8H11NO6S — CID 107216107
5-[[(2S)-2-hydroxypropyl]sulfamoyl]furan-2-carboxylic acid (PubChem CID 107216107) has the molecular formula C8H11NO6S and a molecular weight of 249.24 g/mol. Its IUPAC name is 5-[[(2S)-2-hydroxypropyl]sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-[[(2S)-2-hydroxypropyl]sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 107216107 |
| Molecular Formula | C8H11NO6S |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 5-[[(2S)-2-hydroxypropyl]sulfamoyl]furan-2-carboxylic acid |
| SMILES | C[C@H](O)CNS(=O)(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C8H11NO6S/c1-5(10)4-9-16(13,14)7-3-2-6(15-7)8(11)12/h2-3,5,9-10H,4H2,1H3,(H,11,12)/t5-/m0/s1 |
| InChIKey | OFDMUKJUZZCXGJ-YFKPBYRVSA-N |
| XLogP | -0.36 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |