C8H10BrNO6S — CID 94608926
5-bromo-4-[[(2S)-2-hydroxypropyl]sulfamoyl]furan-2-carboxylic acid (PubChem CID 94608926) has the molecular formula C8H10BrNO6S and a molecular weight of 328.14 g/mol. Its IUPAC name is 5-bromo-4-[[(2S)-2-hydroxypropyl]sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[[(2S)-2-hydroxypropyl]sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 94608926 |
| Molecular Formula | C8H10BrNO6S |
| Molecular Weight | 328.14 g/mol |
| Exact Mass | 326.94 |
| IUPAC Name | 5-bromo-4-[[(2S)-2-hydroxypropyl]sulfamoyl]furan-2-carboxylic acid |
| SMILES | C[C@H](O)CNS(=O)(=O)c1cc(C(=O)O)oc1Br |
| InChI | InChI=1S/C8H10BrNO6S/c1-4(11)3-10-17(14,15)6-2-5(8(12)13)16-7(6)9/h2,4,10-11H,3H2,1H3,(H,12,13)/t4-/m0/s1 |
| InChIKey | MYVVGLRQCKRXMV-BYPYZUCNSA-N |
| XLogP | 0.40 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.14 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |