C10H14BrNO6S — CID 64604213
5-bromo-4-(4-methoxybutan-2-ylsulfamoyl)furan-2-carboxylic acid (PubChem CID 64604213) has the molecular formula C10H14BrNO6S and a molecular weight of 356.19 g/mol. Its IUPAC name is 5-bromo-4-(4-methoxybutan-2-ylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-(4-methoxybutan-2-ylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 64604213 |
| Molecular Formula | C10H14BrNO6S |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 5-bromo-4-(4-methoxybutan-2-ylsulfamoyl)furan-2-carboxylic acid |
| SMILES | COCCC(C)NS(=O)(=O)c1cc(C(=O)O)oc1Br |
| InChI | InChI=1S/C10H14BrNO6S/c1-6(3-4-17-2)12-19(15,16)8-5-7(10(13)14)18-9(8)11/h5-6,12H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | RUDUZYHGPRJHOT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |