5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid

C14H21NO5S — CID 64604818

IUPAC5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid
SMILESCOCCC(C)NS(=O)(=O)c1cc(C(=O)O)c(C)cc1C
InChIInChI=1S/C14H21NO5S/c1-9-7-10(2)13(8-12(9)14(16)17)21(18,19)15-11(3)5-6-20-4/h7-8,11,15H,5-6H2,1-4H3,(H,16,17)
InChIKeyXDVFPLISWOCJHV-UHFFFAOYSA-N
MW315.39 g/mol
LogP1.70
Rot. Bonds7

About 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid

5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid (PubChem CID 64604818) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid.

Molecular Properties

Compound Name5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid
PubChem CID64604818
Molecular FormulaC14H21NO5S
Molecular Weight315.39 g/mol
Exact Mass315.11
IUPAC Name5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid
SMILESCOCCC(C)NS(=O)(=O)c1cc(C(=O)O)c(C)cc1C
InChIInChI=1S/C14H21NO5S/c1-9-7-10(2)13(8-12(9)14(16)17)21(18,19)15-11(3)5-6-20-4/h7-8,11,15H,5-6H2,1-4H3,(H,16,17)
InChIKeyXDVFPLISWOCJHV-UHFFFAOYSA-N
XLogP1.70
TPSA92.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.39
LogP ≤ 51.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid?
The IUPAC name of 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid (CID 64604818) is 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid.
What is the SMILES notation for 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid?
The canonical SMILES for 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid is COCCC(C)NS(=O)(=O)c1cc(C(=O)O)c(C)cc1C.
What is the InChIKey of 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid?
The InChIKey is XDVFPLISWOCJHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO5S/c1-9-7-10(2)13(8-12(9)14(16)17)21(18,19)15-11(3)5-6-20-4/h7-8,11,15H,5-6H2,1-4H3,(H,16,17).
What are the key properties of 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid?
5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid has a molecular weight of 315.39 g/mol, XLogP of 1.70, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid is sourced from PubChem (CID 64604818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).