C14H21NO5S — CID 64604818
5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid (PubChem CID 64604818) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid.
| Compound Name | 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid |
|---|---|
| PubChem CID | 64604818 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 5-(4-methoxybutan-2-ylsulfamoyl)-2,4-dimethylbenzoic acid |
| SMILES | COCCC(C)NS(=O)(=O)c1cc(C(=O)O)c(C)cc1C |
| InChI | InChI=1S/C14H21NO5S/c1-9-7-10(2)13(8-12(9)14(16)17)21(18,19)15-11(3)5-6-20-4/h7-8,11,15H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | XDVFPLISWOCJHV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |