3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid

C12H15F2NO5S — CID 104654581

IUPAC3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid
SMILESCOCCC(C)NS(=O)(=O)c1cc(C(=O)O)cc(F)c1F
InChIInChI=1S/C12H15F2NO5S/c1-7(3-4-20-2)15-21(18,19)10-6-8(12(16)17)5-9(13)11(10)14/h5-7,15H,3-4H2,1-2H3,(H,16,17)
InChIKeyREZADZBABBFRKV-UHFFFAOYSA-N
MW323.32 g/mol
LogP1.37
Rot. Bonds7

About 3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid

3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid (PubChem CID 104654581) has the molecular formula C12H15F2NO5S and a molecular weight of 323.32 g/mol. Its IUPAC name is 3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid.

Molecular Properties

Compound Name3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid
PubChem CID104654581
Molecular FormulaC12H15F2NO5S
Molecular Weight323.32 g/mol
Exact Mass323.06
IUPAC Name3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid
SMILESCOCCC(C)NS(=O)(=O)c1cc(C(=O)O)cc(F)c1F
InChIInChI=1S/C12H15F2NO5S/c1-7(3-4-20-2)15-21(18,19)10-6-8(12(16)17)5-9(13)11(10)14/h5-7,15H,3-4H2,1-2H3,(H,16,17)
InChIKeyREZADZBABBFRKV-UHFFFAOYSA-N
XLogP1.37
TPSA92.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.32
LogP ≤ 51.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid?
The IUPAC name of 3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid (CID 104654581) is 3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid.
What is the SMILES notation for 3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid?
The canonical SMILES for 3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid is COCCC(C)NS(=O)(=O)c1cc(C(=O)O)cc(F)c1F.
What is the InChIKey of 3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid?
The InChIKey is REZADZBABBFRKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2NO5S/c1-7(3-4-20-2)15-21(18,19)10-6-8(12(16)17)5-9(13)11(10)14/h5-7,15H,3-4H2,1-2H3,(H,16,17).
What are the key properties of 3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid?
3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid has a molecular weight of 323.32 g/mol, XLogP of 1.37, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-difluoro-5-(4-methoxybutan-2-ylsulfamoyl)benzoic acid is sourced from PubChem (CID 104654581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).