C13H17F2NO4S — CID 104654442
3,4-difluoro-5-(4-methylpentylsulfamoyl)benzoic acid (PubChem CID 104654442) has the molecular formula C13H17F2NO4S and a molecular weight of 321.35 g/mol. Its IUPAC name is 3,4-difluoro-5-(4-methylpentylsulfamoyl)benzoic acid.
| Compound Name | 3,4-difluoro-5-(4-methylpentylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 104654442 |
| Molecular Formula | C13H17F2NO4S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3,4-difluoro-5-(4-methylpentylsulfamoyl)benzoic acid |
| SMILES | CC(C)CCCNS(=O)(=O)c1cc(C(=O)O)cc(F)c1F |
| InChI | InChI=1S/C13H17F2NO4S/c1-8(2)4-3-5-16-21(19,20)11-7-9(13(17)18)6-10(14)12(11)15/h6-8,16H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | NQFFNGRJPDSCLZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|