C12H15F2NO5S — CID 105115292
3,4-difluoro-5-[(3-hydroxy-2,2-dimethylpropyl)sulfamoyl]benzoic acid (PubChem CID 105115292) has the molecular formula C12H15F2NO5S and a molecular weight of 323.32 g/mol. Its IUPAC name is 3,4-difluoro-5-[(3-hydroxy-2,2-dimethylpropyl)sulfamoyl]benzoic acid.
| Compound Name | 3,4-difluoro-5-[(3-hydroxy-2,2-dimethylpropyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 105115292 |
| Molecular Formula | C12H15F2NO5S |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3,4-difluoro-5-[(3-hydroxy-2,2-dimethylpropyl)sulfamoyl]benzoic acid |
| SMILES | CC(C)(CO)CNS(=O)(=O)c1cc(C(=O)O)cc(F)c1F |
| InChI | InChI=1S/C12H15F2NO5S/c1-12(2,6-16)5-15-21(19,20)9-4-7(11(17)18)3-8(13)10(9)14/h3-4,15-16H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | DLTBLNJYVUJCHL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |