C11H13F2NO5S — CID 106840426
3,4-difluoro-5-(4-hydroxybutylsulfamoyl)benzoic acid (PubChem CID 106840426) has the molecular formula C11H13F2NO5S and a molecular weight of 309.29 g/mol. Its IUPAC name is 3,4-difluoro-5-(4-hydroxybutylsulfamoyl)benzoic acid.
| Compound Name | 3,4-difluoro-5-(4-hydroxybutylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 106840426 |
| Molecular Formula | C11H13F2NO5S |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 3,4-difluoro-5-(4-hydroxybutylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)c(S(=O)(=O)NCCCCO)c1 |
| InChI | InChI=1S/C11H13F2NO5S/c12-8-5-7(11(16)17)6-9(10(8)13)20(18,19)14-3-1-2-4-15/h5-6,14-15H,1-4H2,(H,16,17) |
| InChIKey | QIIINEQWFVFUQZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|