C11H12F2N2O5S — CID 105112995
3-[(4-amino-4-oxobutyl)sulfamoyl]-4,5-difluorobenzoic acid (PubChem CID 105112995) has the molecular formula C11H12F2N2O5S and a molecular weight of 322.29 g/mol. Its IUPAC name is 3-[(4-amino-4-oxobutyl)sulfamoyl]-4,5-difluorobenzoic acid.
| Compound Name | 3-[(4-amino-4-oxobutyl)sulfamoyl]-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 105112995 |
| Molecular Formula | C11H12F2N2O5S |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 3-[(4-amino-4-oxobutyl)sulfamoyl]-4,5-difluorobenzoic acid |
| SMILES | NC(=O)CCCNS(=O)(=O)c1cc(C(=O)O)cc(F)c1F |
| InChI | InChI=1S/C11H12F2N2O5S/c12-7-4-6(11(17)18)5-8(10(7)13)21(19,20)15-3-1-2-9(14)16/h4-5,15H,1-3H2,(H2,14,16)(H,17,18) |
| InChIKey | ZGQKWGKENCTADK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|