C11H13FN2O5S — CID 79187711
4-[(4-amino-4-oxobutyl)sulfamoyl]-3-fluorobenzoic acid (PubChem CID 79187711) has the molecular formula C11H13FN2O5S and a molecular weight of 304.30 g/mol. Its IUPAC name is 4-[(4-amino-4-oxobutyl)sulfamoyl]-3-fluorobenzoic acid.
| Compound Name | 4-[(4-amino-4-oxobutyl)sulfamoyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 79187711 |
| Molecular Formula | C11H13FN2O5S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 4-[(4-amino-4-oxobutyl)sulfamoyl]-3-fluorobenzoic acid |
| SMILES | NC(=O)CCCNS(=O)(=O)c1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C11H13FN2O5S/c12-8-6-7(11(16)17)3-4-9(8)20(18,19)14-5-1-2-10(13)15/h3-4,6,14H,1-2,5H2,(H2,13,15)(H,16,17) |
| InChIKey | JNIVRLSMIMVUHA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|