C11H12FNO7S — CID 107216404
3-fluoro-4-[(2-hydroxy-3-methoxy-3-oxopropyl)sulfamoyl]benzoic acid (PubChem CID 107216404) has the molecular formula C11H12FNO7S and a molecular weight of 321.28 g/mol. Its IUPAC name is 3-fluoro-4-[(2-hydroxy-3-methoxy-3-oxopropyl)sulfamoyl]benzoic acid.
| Compound Name | 3-fluoro-4-[(2-hydroxy-3-methoxy-3-oxopropyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 107216404 |
| Molecular Formula | C11H12FNO7S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 3-fluoro-4-[(2-hydroxy-3-methoxy-3-oxopropyl)sulfamoyl]benzoic acid |
| SMILES | COC(=O)C(O)CNS(=O)(=O)c1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C11H12FNO7S/c1-20-11(17)8(14)5-13-21(18,19)9-3-2-6(10(15)16)4-7(9)12/h2-4,8,13-14H,5H2,1H3,(H,15,16) |
| InChIKey | VLVBXEJTSIEFCB-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |