C10H10F2N2O6S — CID 106168352
3-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-4,5-difluorobenzoic acid (PubChem CID 106168352) has the molecular formula C10H10F2N2O6S and a molecular weight of 324.26 g/mol. Its IUPAC name is 3-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-4,5-difluorobenzoic acid.
| Compound Name | 3-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 106168352 |
| Molecular Formula | C10H10F2N2O6S |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 3-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-4,5-difluorobenzoic acid |
| SMILES | NC(=O)C(O)CNS(=O)(=O)c1cc(C(=O)O)cc(F)c1F |
| InChI | InChI=1S/C10H10F2N2O6S/c11-5-1-4(10(17)18)2-7(8(5)12)21(19,20)14-3-6(15)9(13)16/h1-2,6,14-15H,3H2,(H2,13,16)(H,17,18) |
| InChIKey | ZFWXVUORRZEKIQ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |