C9H10F2N2O4S — CID 107258385
3-[(2,5-difluorophenyl)sulfonylamino]-2-hydroxypropanamide (PubChem CID 107258385) has the molecular formula C9H10F2N2O4S and a molecular weight of 280.25 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)sulfonylamino]-2-hydroxypropanamide.
| Compound Name | 3-[(2,5-difluorophenyl)sulfonylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 107258385 |
| Molecular Formula | C9H10F2N2O4S |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 3-[(2,5-difluorophenyl)sulfonylamino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C9H10F2N2O4S/c10-5-1-2-6(11)8(3-5)18(16,17)13-4-7(14)9(12)15/h1-3,7,13-14H,4H2,(H2,12,15) |
| InChIKey | SEHNJXMKQWEQPE-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |