C10H12FNO5S — CID 66168147
3-[(2-fluoro-5-methylphenyl)sulfonylamino]-2-hydroxypropanoic acid (PubChem CID 66168147) has the molecular formula C10H12FNO5S and a molecular weight of 277.27 g/mol. Its IUPAC name is 3-[(2-fluoro-5-methylphenyl)sulfonylamino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(2-fluoro-5-methylphenyl)sulfonylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66168147 |
| Molecular Formula | C10H12FNO5S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 3-[(2-fluoro-5-methylphenyl)sulfonylamino]-2-hydroxypropanoic acid |
| SMILES | Cc1ccc(F)c(S(=O)(=O)NCC(O)C(=O)O)c1 |
| InChI | InChI=1S/C10H12FNO5S/c1-6-2-3-7(11)9(4-6)18(16,17)12-5-8(13)10(14)15/h2-4,8,12-13H,5H2,1H3,(H,14,15) |
| InChIKey | DBNPUJGFILCWQH-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |