C11H14FNO5S — CID 103878696
methyl 3-[(2-fluoro-5-methylphenyl)sulfonylamino]-2-hydroxypropanoate (PubChem CID 103878696) has the molecular formula C11H14FNO5S and a molecular weight of 291.30 g/mol. Its IUPAC name is methyl 3-[(2-fluoro-5-methylphenyl)sulfonylamino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(2-fluoro-5-methylphenyl)sulfonylamino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 103878696 |
| Molecular Formula | C11H14FNO5S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | methyl 3-[(2-fluoro-5-methylphenyl)sulfonylamino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNS(=O)(=O)c1cc(C)ccc1F |
| InChI | InChI=1S/C11H14FNO5S/c1-7-3-4-8(12)10(5-7)19(16,17)13-6-9(14)11(15)18-2/h3-5,9,13-14H,6H2,1-2H3 |
| InChIKey | KLHOIYNCUIHTRU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |